3-chloro-N-[(2,3-dimethoxyphenyl)methyl]-4-methyl-aniline
Modify Date: 2025-09-15 14:56:16
![3-chloro-N-[(2,3-dimethoxyphenyl)methyl]-4-methyl-aniline Structure](https://image.chemsrc.com/caspic/297/84474-05-5.png)
3-chloro-N-[(2,3-dimethoxyphenyl)methyl]-4-methyl-aniline structure
|
Common Name | 3-chloro-N-[(2,3-dimethoxyphenyl)methyl]-4-methyl-aniline | ||
|---|---|---|---|---|
| CAS Number | 84474-05-5 | Molecular Weight | 291.77300 | |
| Density | 1.186g/cm3 | Boiling Point | 407.6ºC at 760 mmHg | |
| Molecular Formula | C16H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.3ºC | |
| Name | 3-chloro-N-[(2,3-dimethoxyphenyl)methyl]-4-methylaniline |
|---|
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 407.6ºC at 760 mmHg |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.77300 |
| Flash Point | 200.3ºC |
| Exact Mass | 291.10300 |
| PSA | 30.49000 |
| LogP | 4.35070 |
| Index of Refraction | 1.594 |
| InChIKey | BAQAIKMAMCQPFK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NCC2=C(C(=CC=C2)OC)OC)Cl |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |