2-(4-chloro-2-fluoro-5-hydroxyphenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione structure
|
Common Name | 2-(4-chloro-2-fluoro-5-hydroxyphenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 84478-41-1 | Molecular Weight | 295.69300 | |
| Density | 1.55g/cm3 | Boiling Point | 482.9ºC at 760 mmHg | |
| Molecular Formula | C14H11ClFNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.8ºC | |
| Name | 2-(4-chloro-2-fluoro-5-hydroxyphenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 482.9ºC at 760 mmHg |
| Molecular Formula | C14H11ClFNO3 |
| Molecular Weight | 295.69300 |
| Flash Point | 245.8ºC |
| Exact Mass | 295.04100 |
| PSA | 57.61000 |
| LogP | 2.99350 |
| Index of Refraction | 1.654 |
| InChIKey | CGWJDVCUCCBSNL-UHFFFAOYSA-N |
| SMILES | O=C1C2=C(CCCC2)C(=O)N1c1cc(O)c(Cl)cc1F |
|
~%
2-(4-chloro-2-f... CAS#:84478-41-1 |
| Literature: Ando, Iwao; Ohtsuka, Toshikazu; Miki, Nobuo; Takahashi, Toshio; Hayase, Yoshio; Hayashi, Yoshiyuki Agricultural and Biological Chemistry, 1989 , vol. 53, # 7 p. 2001 - 2004 |
|
~%
2-(4-chloro-2-f... CAS#:84478-41-1 |
| Literature: Ando, Iwao; Ohtsuka, Toshikazu; Miki, Nobuo; Takahashi, Toshio; Hayase, Yoshio; Hayashi, Yoshiyuki Agricultural and Biological Chemistry, 1989 , vol. 53, # 7 p. 2001 - 2004 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |