2-Amino-6-bromo-5-nitropyridine structure
|
Common Name | 2-Amino-6-bromo-5-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 84487-05-8 | Molecular Weight | 218.00800 | |
| Density | 1.93g/cm3 | Boiling Point | 357.488ºC at 760 mmHg | |
| Molecular Formula | C5H4BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.003ºC | |
| Name | 6-bromo-5-nitropyridin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.93g/cm3 |
|---|---|
| Boiling Point | 357.488ºC at 760 mmHg |
| Molecular Formula | C5H4BrN3O2 |
| Molecular Weight | 218.00800 |
| Flash Point | 170.003ºC |
| Exact Mass | 216.94900 |
| PSA | 84.73000 |
| LogP | 2.43890 |
| Index of Refraction | 1.683 |
| InChIKey | GSICIBOPCHOCJK-UHFFFAOYSA-N |
| SMILES | Nc1ccc([N+](=O)[O-])c(Br)n1 |
| HS Code | 2933399090 |
|---|
|
~84%
2-Amino-6-bromo... CAS#:84487-05-8 |
| Literature: VERTEX PHARMACEUTICALS INCORPORATED Patent: WO2008/141119 A2, 2008 ; Location in patent: Page/Page column 84 ; WO 2008/141119 A2 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Amino-6-bromo-5-nitropyridine |
| 2-Pyridinamine,6-bromo-5-nitro |