(3,4-dichlorophenyl)-(4-propan-2-ylphenyl)methanone structure
|
Common Name | (3,4-dichlorophenyl)-(4-propan-2-ylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 844885-26-3 | Molecular Weight | 293.18800 | |
| Density | 1.213g/cm3 | Boiling Point | 408.7ºC at 760 mmHg | |
| Molecular Formula | C16H14Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.7ºC | |
| Name | (3,4-dichlorophenyl)-(4-propan-2-ylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 408.7ºC at 760 mmHg |
| Molecular Formula | C16H14Cl2O |
| Molecular Weight | 293.18800 |
| Flash Point | 172.7ºC |
| Exact Mass | 292.04200 |
| PSA | 17.07000 |
| LogP | 5.34780 |
| Index of Refraction | 1.576 |
| InChIKey | MFPLPBSZEBSIFM-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(C(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3,4-dichloro-4'-isopropylbenzophenone |