tert-Butyl 4-formyl-3,5-dimethyl-1H-pyrazole-1-carboxylate structure
|
Common Name | tert-Butyl 4-formyl-3,5-dimethyl-1H-pyrazole-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 844891-13-0 | Molecular Weight | 224.25600 | |
| Density | 1.12g/cm3 | Boiling Point | 338.2ºC at 760 mmHg | |
| Molecular Formula | C11H16N2O3 | Melting Point | 59ºC | |
| MSDS | N/A | Flash Point | 158.3ºC | |
| Name | tert-Butyl 4-formyl-3,5-dimethyl-1H-pyrazole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 338.2ºC at 760 mmHg |
| Melting Point | 59ºC |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.25600 |
| Flash Point | 158.3ºC |
| Exact Mass | 224.11600 |
| PSA | 61.19000 |
| LogP | 2.09560 |
| Index of Refraction | 1.519 |
| InChIKey | AZJWODKWFMBMCM-UHFFFAOYSA-N |
| SMILES | Cc1nn(C(=O)OC(C)(C)C)c(C)c1C=O |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 4-formyl-3,5-dimethylpyrazole-1-carboxylate |