7-Acetoxycytochalasin H
Modify Date: 2025-09-09 21:17:36
7-Acetoxycytochalasin H structure
|
Common Name | 7-Acetoxycytochalasin H | ||
|---|---|---|---|---|
| CAS Number | 84499-89-8 | Molecular Weight | 535.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H41NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-Acetoxycytochalasin H |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C32H41NO6 |
|---|---|
| Molecular Weight | 535.7 |
| InChIKey | QTMFSRBHTRHUHE-MPMZSRJWSA-N |
| SMILES | C=C1C(C)C2C(Cc3ccccc3)NC(=O)C23C(OC(C)=O)C=CC(C)(O)CC(C)CC=CC3C1OC(C)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 7-Acetoxycytochalasin H? |
| A: SMILES notation of 7-Acetoxycytochalasin H is C=C1C(C)C2C(Cc3ccccc3)NC(=O)C23C(OC(C)=O)C=CC(C)(O)CC(C)CC=CC3C1OC(C)=O. |
| Q: What is the molecular weight of 7-Acetoxycytochalasin H? |
| A: Molecular weight of 7-Acetoxycytochalasin H is 535.7. |
| Q: What is the molecular formula of 7-Acetoxycytochalasin H? |
| A: Molecular formula of 7-Acetoxycytochalasin H is C32H41NO6. |
| Q: What is the English name of 7-Acetoxycytochalasin H? |
| A: The English name of 7-Acetoxycytochalasin H is 7-Acetoxycytochalasin H. |
| Q: What is the InChIKey of 7-Acetoxycytochalasin H? |
| A: InChIKey of 7-Acetoxycytochalasin H is QTMFSRBHTRHUHE-MPMZSRJWSA-N. |
| Q: What is the CAS number of 7-Acetoxycytochalasin H? |
| A: CAS number of 7-Acetoxycytochalasin H is 84499-89-8. |
| Q: What is the Chinese name of 84499-89-8? |
| A: Chinese name of 84499-89-8 is 84499-89-8. |