2-[[(3-chloro-4-methyl-phenyl)amino]methyl]isoindole-1,3-dione structure
|
Common Name | 2-[[(3-chloro-4-methyl-phenyl)amino]methyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 84501-73-5 | Molecular Weight | 300.74000 | |
| Density | 1.394g/cm3 | Boiling Point | 488ºC at 760 mmHg | |
| Molecular Formula | C16H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.9ºC | |
| Name | 2-[(3-chloro-4-methylanilino)methyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.394g/cm3 |
|---|---|
| Boiling Point | 488ºC at 760 mmHg |
| Molecular Formula | C16H13ClN2O2 |
| Molecular Weight | 300.74000 |
| Flash Point | 248.9ºC |
| Exact Mass | 300.06700 |
| PSA | 49.41000 |
| LogP | 3.32490 |
| Index of Refraction | 1.676 |
| InChIKey | YRLWTVJREYZUKS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NCN2C(=O)c3ccccc3C2=O)cc1Cl |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1h-isoindole-1,3(2h)-dione,2-[[(3-chloro-4-methylphenyl)amino]methyl] |