6-methyl-1,4-diphenylpyrimidine-2-thione
6-methyl-1,4-diphenylpyrimidine-2-thione structure
|
Common Name | 6-methyl-1,4-diphenylpyrimidine-2-thione | ||
|---|---|---|---|---|
| CAS Number | 84512-75-4 | Molecular Weight | 278.37100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 6-Methyl-1,4-diphenylpyrimidine-2-thione, CAS number 84512-75-4, with molecular formula C17H14N2S and molecular weight 278.37100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-methyl-1,4-diphenylpyrimidine-2-thione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H14N2S |
|---|---|
| Molecular Weight | 278.37100 |
| Exact Mass | 278.08800 |
| PSA | 49.91000 |
| LogP | 4.57720 |
| InChIKey | OZQZFSJABGMBLP-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2ccccc2)nc(=S)n1-c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
6-methyl-1,4-di... CAS#:84512-75-4 |
| Literature: Katoh, Akira; Kashima, Choji; Omote, Yoshimori Heterocycles, 1982 , vol. 19, # 12 p. 2283 - 2286 |
|
~%
6-methyl-1,4-di... CAS#:84512-75-4 |
| Literature: Zylewska, Alicja; Tejchman, Waldemar; Korohoda, Maria J.; Zylewski, Marek Heterocycles, 2003 , vol. 60, # 12 p. 2749 - 2760 |
|
~%
6-methyl-1,4-di... CAS#:84512-75-4 |
| Literature: Zylewska, Alicja; Tejchman, Waldemar; Korohoda, Maria J.; Zylewski, Marek Heterocycles, 2003 , vol. 60, # 12 p. 2749 - 2760 |
|
~%
6-methyl-1,4-di... CAS#:84512-75-4 |
| Literature: Kashima, Choji; Katoh, Akira; Yokota, Yuko; Omote, Yoshimori Synthesis, 1983 , # 2 p. 151 - 153 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 6-methyl-1,4-diphenylpyrimidine-2-thione? |
| A: CAS number of 6-methyl-1,4-diphenylpyrimidine-2-thione is 84512-75-4. |
| Q: What is the English name of 6-methyl-1,4-diphenylpyrimidine-2-thione? |
| A: The English name of 6-methyl-1,4-diphenylpyrimidine-2-thione is 6-methyl-1,4-diphenylpyrimidine-2-thione. |
| Q: What is the molecular formula of 6-methyl-1,4-diphenylpyrimidine-2-thione? |
| A: Molecular formula of 6-methyl-1,4-diphenylpyrimidine-2-thione is C17H14N2S. |
| Q: What is the Chinese name of 84512-75-4? |
| A: Chinese name of 84512-75-4 is 84512-75-4. |
| Q: What is the SMILES notation of 6-methyl-1,4-diphenylpyrimidine-2-thione? |
| A: SMILES notation of 6-methyl-1,4-diphenylpyrimidine-2-thione is Cc1cc(-c2ccccc2)nc(=S)n1-c1ccccc1. |
| Q: What is the polar surface area (PSA) of 6-methyl-1,4-diphenylpyrimidine-2-thione? |
| A: Polar surface area (PSA) of 6-methyl-1,4-diphenylpyrimidine-2-thione is 49.91000. |
| Q: What is the InChIKey of 6-methyl-1,4-diphenylpyrimidine-2-thione? |
| A: InChIKey of 6-methyl-1,4-diphenylpyrimidine-2-thione is OZQZFSJABGMBLP-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 6-methyl-1,4-diphenylpyrimidine-2-thione? |
| A: Related upstream materials(CAS) of 6-methyl-1,4-diphenylpyrimidine-2-thione: 74152-13-9;64-10-8;93-91-4;103-72-0. |
| Q: What is the molecular weight of 6-methyl-1,4-diphenylpyrimidine-2-thione? |
| A: Molecular weight of 6-methyl-1,4-diphenylpyrimidine-2-thione is 278.37100. |
| Q: What is the LogP of 6-methyl-1,4-diphenylpyrimidine-2-thione? |
| A: LogP of 6-methyl-1,4-diphenylpyrimidine-2-thione is 4.57720. |