N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine
N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine structure
|
Common Name | N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 84523-80-8 | Molecular Weight | 279.76500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-(4-Chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine (Chinese name: N-(4-氯丁基)-4-甲氧基-N-甲基喹唑啉-2-胺, CAS number: 84523-80-8, molecular formula: C14H18ClN3O, molecular weight: 279.76500), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18ClN3O |
|---|---|
| Molecular Weight | 279.76500 |
| Exact Mass | 279.11400 |
| PSA | 38.25000 |
| LogP | 3.09360 |
| InChIKey | YBBZJNCFNVOZPI-UHFFFAOYSA-N |
| SMILES | COc1nc(N(C)CCCCCl)nc2ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~90%
N-(4-chlorobuty... CAS#:84523-80-8 |
| Literature: Miki, Hideki; Kasahara, Fumiko Chemical & Pharmaceutical Bulletin, 1982 , vol. 30, # 10 p. 3471 - 3475 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine? |
| A: The English name of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine is N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine. |
| Q: What is the InChIKey of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine? |
| A: InChIKey of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine is YBBZJNCFNVOZPI-UHFFFAOYSA-N. |
| Q: What are the upstream materials of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine? |
| A: Related upstream materials(CAS) of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine: 120-94-5;77767-98-7. |
| Q: What is the molecular weight of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine? |
| A: Molecular weight of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine is 279.76500. |
| Q: What is the SMILES notation of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine? |
| A: SMILES notation of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine is COc1nc(N(C)CCCCCl)nc2ccccc12. |
| Q: What is the Chinese name of 84523-80-8? |
| A: Chinese name of 84523-80-8 is 84523-80-8. |
| Q: What is the polar surface area (PSA) of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine? |
| A: Polar surface area (PSA) of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine is 38.25000. |
| Q: What is the molecular formula of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine? |
| A: Molecular formula of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine is C14H18ClN3O. |
| Q: What is the CAS number of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine? |
| A: CAS number of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine is 84523-80-8. |
| Q: What is the LogP of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine? |
| A: LogP of N-(4-chlorobutyl)-4-methoxy-N-methylquinazolin-2-amine is 3.09360. |