N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine
N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine structure
|
Common Name | N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 84523-81-9 | Molecular Weight | 295.83100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18ClN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-(4-Chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine (CAS number: 84523-81-9), molecular formula C14H18ClN3S, molecular weight 295.83100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18ClN3S |
|---|---|
| Molecular Weight | 295.83100 |
| Exact Mass | 295.09100 |
| PSA | 54.32000 |
| LogP | 3.80690 |
| InChIKey | OPXZNRBGZPSBGZ-UHFFFAOYSA-N |
| SMILES | CSc1nc(N(C)CCCCCl)nc2ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
N-(4-chlorobuty... CAS#:84523-81-9 |
| Literature: Miki, Hideki; Kasahara, Fumiko Chemical & Pharmaceutical Bulletin, 1982 , vol. 30, # 10 p. 3471 - 3475 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine? |
| A: Related upstream materials(CAS) of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine: 120-94-5;66433-07-6. |
| Q: What is the InChIKey of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine? |
| A: InChIKey of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine is OPXZNRBGZPSBGZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine? |
| A: Molecular formula of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine is C14H18ClN3S. |
| Q: What is the polar surface area (PSA) of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine? |
| A: Polar surface area (PSA) of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine is 54.32000. |
| Q: What is the CAS number of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine? |
| A: CAS number of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine is 84523-81-9. |
| Q: What is the LogP of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine? |
| A: LogP of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine is 3.80690. |
| Q: What is the molecular weight of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine? |
| A: Molecular weight of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine is 295.83100. |
| Q: What is the English name of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine? |
| A: The English name of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine is N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine. |
| Q: What is the SMILES notation of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine? |
| A: SMILES notation of N-(4-chlorobutyl)-N-methyl-4-methylsulfanylquinazolin-2-amine is CSc1nc(N(C)CCCCCl)nc2ccccc12. |
| Q: What is the Chinese name of 84523-81-9? |
| A: Chinese name of 84523-81-9 is 84523-81-9. |