2,2'-Dibromo-4,4'-dimethoxybiphenyl
Modify Date: 2025-11-02 09:13:39
2,2'-Dibromo-4,4'-dimethoxybiphenyl structure
|
Common Name | 2,2'-Dibromo-4,4'-dimethoxybiphenyl | ||
|---|---|---|---|---|
| CAS Number | 84530-63-2 | Molecular Weight | 372.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2'-Dibromo-4,4'-dimethoxybiphenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12Br2O2 |
|---|---|
| Molecular Weight | 372.05 |
| InChIKey | LJAHZCXRQBQPII-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ccc(OC)cc2Br)c(Br)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,2'-Dibromo-4,4'-dimethoxybiphenyl? |
| A: CAS number of 2,2'-Dibromo-4,4'-dimethoxybiphenyl is 84530-63-2. |
| Q: What is the molecular formula of 2,2'-Dibromo-4,4'-dimethoxybiphenyl? |
| A: Molecular formula of 2,2'-Dibromo-4,4'-dimethoxybiphenyl is C14H12Br2O2. |
| Q: What is the Chinese name of 84530-63-2? |
| A: Chinese name of 84530-63-2 is 84530-63-2. |
| Q: What is the English name of 2,2'-Dibromo-4,4'-dimethoxybiphenyl? |
| A: The English name of 2,2'-Dibromo-4,4'-dimethoxybiphenyl is 2,2'-Dibromo-4,4'-dimethoxybiphenyl. |
| Q: What is the InChIKey of 2,2'-Dibromo-4,4'-dimethoxybiphenyl? |
| A: InChIKey of 2,2'-Dibromo-4,4'-dimethoxybiphenyl is LJAHZCXRQBQPII-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2,2'-Dibromo-4,4'-dimethoxybiphenyl? |
| A: Molecular weight of 2,2'-Dibromo-4,4'-dimethoxybiphenyl is 372.05. |
| Q: What is the SMILES notation of 2,2'-Dibromo-4,4'-dimethoxybiphenyl? |
| A: SMILES notation of 2,2'-Dibromo-4,4'-dimethoxybiphenyl is COc1ccc(-c2ccc(OC)cc2Br)c(Br)c1. |