methyl 4,6-dimethoxynaphthalene-1-carboxylate
methyl 4,6-dimethoxynaphthalene-1-carboxylate structure
|
Common Name | methyl 4,6-dimethoxynaphthalene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 84533-49-3 | Molecular Weight | 246.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Methyl 4,6-dimethoxynaphthalene-1-carboxylate, Chinese name 甲基4,6-二甲氧基萘-1-甲酸酯, CAS number 84533-49-3, molecular formula C14H14O4, molecular weight 246.25900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 4,6-dimethoxynaphthalene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14O4 |
|---|---|
| Molecular Weight | 246.25900 |
| Exact Mass | 246.08900 |
| PSA | 44.76000 |
| LogP | 2.64360 |
| InChIKey | RKWJGQUAYXKOGJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OC)c2cc(OC)ccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~85%
methyl 4,6-dime... CAS#:84533-49-3 |
| Literature: Bhattacharyya, Sukanta; Basu, Basudeb; Mukherjee, Debabrata Tetrahedron, 1983 , vol. 39, # 24 p. 4221 - 4224 |
|
~%
methyl 4,6-dime... CAS#:84533-49-3 |
| Literature: Bhattacharyya, Sukanta; Basu, Basudeb; Mukherjee, Debabrata Tetrahedron, 1983 , vol. 39, # 24 p. 4221 - 4224 |
|
~%
methyl 4,6-dime... CAS#:84533-49-3 |
| Literature: Bhattacharyya, Sukanta; Basu, Basudeb; Mukherjee, Debabrata Tetrahedron, 1983 , vol. 39, # 24 p. 4221 - 4224 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| methyl 4,6-dimethoxy-1-naphthoate |
| 1-Naphthalenecarboxylic acid,4,6-dimethoxy-,methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of methyl 4,6-dimethoxynaphthalene-1-carboxylate? |
| A: CAS number of methyl 4,6-dimethoxynaphthalene-1-carboxylate is 84533-49-3. |
| Q: What is the molecular formula of methyl 4,6-dimethoxynaphthalene-1-carboxylate? |
| A: Molecular formula of methyl 4,6-dimethoxynaphthalene-1-carboxylate is C14H14O4. |
| Q: What is the molecular weight of methyl 4,6-dimethoxynaphthalene-1-carboxylate? |
| A: Molecular weight of methyl 4,6-dimethoxynaphthalene-1-carboxylate is 246.25900. |
| Q: What English synonyms does methyl 4,6-dimethoxynaphthalene-1-carboxylate have? |
| A: English synonyms of methyl 4,6-dimethoxynaphthalene-1-carboxylate: methyl 4,6-dimethoxy-1-naphthoate, 1-Naphthalenecarboxylic acid,4,6-dimethoxy-,methyl ester. |
| Q: What are the upstream materials of methyl 4,6-dimethoxynaphthalene-1-carboxylate? |
| A: Related upstream materials(CAS) of methyl 4,6-dimethoxynaphthalene-1-carboxylate: 67-56-1;84533-48-2;90036-55-8;65565-33-5. |
| Q: What is the SMILES notation of methyl 4,6-dimethoxynaphthalene-1-carboxylate? |
| A: SMILES notation of methyl 4,6-dimethoxynaphthalene-1-carboxylate is COC(=O)c1ccc(OC)c2cc(OC)ccc12. |
| Q: What is the InChIKey of methyl 4,6-dimethoxynaphthalene-1-carboxylate? |
| A: InChIKey of methyl 4,6-dimethoxynaphthalene-1-carboxylate is RKWJGQUAYXKOGJ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 84533-49-3? |
| A: Chinese name of 84533-49-3 is 84533-49-3. |
| Q: What is the English name of methyl 4,6-dimethoxynaphthalene-1-carboxylate? |
| A: The English name of methyl 4,6-dimethoxynaphthalene-1-carboxylate is methyl 4,6-dimethoxynaphthalene-1-carboxylate. |
| Q: What is the polar surface area (PSA) of methyl 4,6-dimethoxynaphthalene-1-carboxylate? |
| A: Polar surface area (PSA) of methyl 4,6-dimethoxynaphthalene-1-carboxylate is 44.76000. |