6-bromo-2-(bromomethyl)-3-phenylquinazolin-4-one structure
|
Common Name | 6-bromo-2-(bromomethyl)-3-phenylquinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 84546-13-4 | Molecular Weight | 394.06100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10Br2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-bromo-2-(bromomethyl)-3-phenylquinazolin-4-one |
|---|
| Molecular Formula | C15H10Br2N2O |
|---|---|
| Molecular Weight | 394.06100 |
| Exact Mass | 391.91600 |
| PSA | 34.89000 |
| LogP | 4.04310 |
| InChIKey | GEULXFOKJDAYOC-UHFFFAOYSA-N |
| SMILES | O=c1c2cc(Br)ccc2nc(CBr)n1-c1ccccc1 |
|
~33%
6-bromo-2-(brom... CAS#:84546-13-4 |
| Literature: Rani, Preeti; Archana; Srivastava; Kumar, Ashok Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2002 , vol. 41, # 12 p. 2642 - 2646 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |