2-(hydroxymethylidene)-5,5-dimethylcyclohexane-1,3-dione structure
|
Common Name | 2-(hydroxymethylidene)-5,5-dimethylcyclohexane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 84548-15-2 | Molecular Weight | 168.19000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(hydroxymethylidene)-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H12O3 |
|---|---|
| Molecular Weight | 168.19000 |
| Exact Mass | 168.07900 |
| PSA | 54.37000 |
| LogP | 1.38650 |
| InChIKey | IBJHHTXBSACNEB-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)C(=CO)C(=O)C1 |
|
~%
2-(hydroxymethy... CAS#:84548-15-2 |
| Literature: Asami, Tadao; Takahashi, Nobutaka; Yoshida, Shigeo Agricultural and Biological Chemistry, 1987 , vol. 51, # 1 p. 205 - 210 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-Cyclohexene-1-carboxaldehyde,2-hydroxy-4,4-dimethyl-6-oxo |
| 2-hydroxy-4,4-dimethyl-6-oxo-1-cyclohexenecarbaldehyde |
| enol form of 2-formyl-5,5-dimethyl-1,3-cyclohexanedione |
| 2-hydroxy-4,4-dimethyl-6-oxocyclohex-1-enecarbaldehyde |
| 5-formyl-4,4-dimethyl-1,3-cyclohexanedione |
| 2-formyldimedone |