(±)5(6)-DiHETE structure
|
Common Name | (±)5(6)-DiHETE | ||
|---|---|---|---|---|
| CAS Number | 845673-97-4 | Molecular Weight | 336.466 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 515.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.8±26.6 °C | |
Use of (±)5(6)-DiHETE±)5(6)-DiHETE is a possible metabolite produced from EPA following epoxidation of the α-5 double bond. |
| Name | 5,6-DiHETE |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 515.8±50.0 °C at 760 mmHg |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.466 |
| Flash Point | 279.8±26.6 °C |
| Exact Mass | 336.230072 |
| PSA | 77.76000 |
| LogP | 3.62 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | VPXVODYVPILPRC-LTKCOYKYSA-N |
| SMILES | CCC=CCC=CCC=CCC=CCC(O)C(O)CCCC(=O)O |
|
~99%
(±)5(6)-DiHETE CAS#:845673-97-4 |
| Literature: Langseter, Anne Marie; Stenstroom, Yngve; Skattebool, Lars Molecules, 2014 , vol. 19, # 3 p. 3804 - 3812 |
|
~%
(±)5(6)-DiHETE CAS#:845673-97-4 |
| Literature: Holmeide, Anne Kristin; Skattebol, Lars Journal of the Chemical Society, Perkin Transactions 1, 2000 , # 14 p. 2271 - 2276 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Dihydrouridine |
| (8Z,11Z,14Z,17Z)-5,6-Dihydroxy-8,11,14,17-icosatetraenoic acid |
| 5,6-Dihydrouridin |
| Uridine,5,6-dihydro |
| 8,11,14,17-Eicosatetraenoic acid, 5,6-dihydroxy-, (8Z,11Z,14Z,17Z)- |
| 3,4-Dihydrouridine |
| base dihydrouridine |