4-(6-(Trifluoromethyl)pyridin-3-yl)benzoic acid structure
|
Common Name | 4-(6-(Trifluoromethyl)pyridin-3-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 845826-95-1 | Molecular Weight | 267.20300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[6-(trifluoromethyl)pyridin-3-yl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8F3NO2 |
|---|---|
| Molecular Weight | 267.20300 |
| Exact Mass | 267.05100 |
| PSA | 50.19000 |
| LogP | 3.46560 |
| InChIKey | FOOREMKGBPKDRA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ccc(C(F)(F)F)nc2)cc1 |
| HS Code | 2933399090 |
|---|
|
~%
4-(6-(Trifluoro... CAS#:845826-95-1 |
| Literature: ELI LILLY AND COMPANY Patent: WO2005/97740 A1, 2005 ; Location in patent: Page/Page column 34-35 ; WO 2005/097740 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-[6-(trifluoromethyl)-pyridin-3-yl]benzenecarboxylic acid |
| Benzoic acid,4-[6-(trifluoromethyl)-3-pyridinyl] |
| 4-(6-trifluoromethyl-pyridin-3-yl)-benzoic acid |