2-methyl-4-phenyloctane-2,4-diol structure
|
Common Name | 2-methyl-4-phenyloctane-2,4-diol | ||
|---|---|---|---|---|
| CAS Number | 84599-53-1 | Molecular Weight | 236.35000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-4-phenyloctane-2,4-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H24O2 |
|---|---|
| Molecular Weight | 236.35000 |
| Exact Mass | 236.17800 |
| PSA | 40.46000 |
| LogP | 3.22540 |
| InChIKey | MYNZZWTWSHKWIP-UHFFFAOYSA-N |
| SMILES | CCCCC(O)(CC(C)(C)O)c1ccccc1 |
|
~%
2-methyl-4-phen... CAS#:84599-53-1 |
| Literature: Barluenga, Jose; Florez, Josefa; Yus, Miguel Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 3019 - 3026 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,4-Octanediol,2-methyl-4-phenyl |