Stannane,methylenebis[chlorodiphenyl- (9CI) structure
|
Common Name | Stannane,methylenebis[chlorodiphenyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 84633-99-8 | Molecular Weight | 630.75000 | |
| Density | N/A | Boiling Point | 549.9ºC at 760mmHg | |
| Molecular Formula | C25H22Cl2Sn2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.4ºC | |
| Name | chloro-[[chloro(diphenyl)stannyl]methyl]-diphenylstannane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 549.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C25H22Cl2Sn2 |
| Molecular Weight | 630.75000 |
| Flash Point | 286.4ºC |
| Exact Mass | 631.91400 |
| LogP | 4.52300 |
| InChIKey | YLXJGTSSAOFWCQ-UHFFFAOYSA-L |
| SMILES | Cl[Sn](C[Sn](Cl)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
|
~75%
Stannane,methyl... CAS#:84633-99-8 |
| Literature: Gielen, M.; Jurkschat, K. Journal of Organometallic Chemistry, 1984 , vol. 273, # 3 p. 303 - 312 |
|
~%
Stannane,methyl... CAS#:84633-99-8 |
| Literature: Engel, Michele; Devaud, Marguerite Journal of Chemical Research, Synopses, 1984 , p. 152 - 153 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| bis(chlorodiphenylstannyl)methane |
| Stannane,methylenebis[chlorodiphenyl |