4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid
4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid structure
|
Common Name | 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 84635-32-5 | Molecular Weight | 263.33200 | |
| Density | 1.34g/cm3 | Boiling Point | 472ºC at 760 mmHg | |
| Molecular Formula | C15H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.2ºC | |
Summary: 4-(2-Oxopyrrolidin-1-yl)adamantane-1-carboxylic acid (CAS: 84635-32-5), molecular formula C15H21NO3, molecular weight 263.33200, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 472ºC at 760 mmHg |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.33200 |
| Flash Point | 239.2ºC |
| Exact Mass | 263.15200 |
| PSA | 57.61000 |
| LogP | 1.82620 |
| Index of Refraction | 1.613 |
| InChIKey | YSDNZHLMWUXRNT-UHFFFAOYSA-N |
| SMILES | O=C1CCCN1C1C2CC3CC1CC(C(=O)O)(C3)C2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~78%
4-(2-oxopyrroli... CAS#:84635-32-5 |
| Literature: Lavrova, L. N.; Shalyminova, Yu. A.; Klimova, N. V.; Artsimovich, N. G. Pharmaceutical Chemistry Journal, 1982 , vol. 16, # 10 p. 757 - 760 Khimiko-Farmatsevticheskii Zhurnal, 1982 , vol. 16, # 10 p. 1197 - 1201 |
|
~%
4-(2-oxopyrroli... CAS#:84635-32-5 |
| Literature: Lavrova, L. N.; Shalyminova, Yu. A.; Klimova, N. V.; Artsimovich, N. G. Pharmaceutical Chemistry Journal, 1982 , vol. 16, # 10 p. 757 - 760 Khimiko-Farmatsevticheskii Zhurnal, 1982 , vol. 16, # 10 p. 1197 - 1201 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid? |
| A: Boiling point of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid is 472ºC at 760 mmHg. |
| Q: What is the molecular weight of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid? |
| A: Molecular weight of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid is 263.33200. |
| Q: What is the LogP of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid? |
| A: LogP of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid is 1.82620. |
| Q: What is the polar surface area (PSA) of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid? |
| A: Polar surface area (PSA) of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid is 57.61000. |
| Q: What is the InChIKey of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid? |
| A: InChIKey of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid is YSDNZHLMWUXRNT-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid? |
| A: SMILES notation of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid is O=C1CCCN1C1C2CC3CC1CC(C(=O)O)(C3)C2. |
| Q: What is the English name of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid? |
| A: The English name of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid is 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid. |
| Q: What are the upstream materials of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid? |
| A: Related upstream materials(CAS) of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid: 64-18-6;84709-80-8;20098-14-0. |
| Q: What is the Chinese name of 84635-32-5? |
| A: Chinese name of 84635-32-5 is 84635-32-5. |
| Q: What is the CAS number of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid? |
| A: CAS number of 4-(2-oxopyrrolidin-1-yl)adamantane-1-carboxylic acid is 84635-32-5. |