N-benzoyl-ε-aminocapramide
N-benzoyl-ε-aminocapramide structure
|
Common Name | N-benzoyl-ε-aminocapramide | ||
|---|---|---|---|---|
| CAS Number | 84636-44-2 | Molecular Weight | 234.29400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-benzoyl-ε-aminocapramide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18N2O2 |
|---|---|
| Molecular Weight | 234.29400 |
| Exact Mass | 234.13700 |
| PSA | 72.19000 |
| LogP | 2.55330 |
| InChIKey | SPOXYFZZNLEOAJ-UHFFFAOYSA-N |
| SMILES | NC(=O)CCCCCNC(=O)c1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:956-09-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-Benzoylamino-hexansaeure-amid |
| 6-benzoylamino-hexanoic acid amide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-benzoyl-ε-aminocapramide? |
| A: InChIKey of N-benzoyl-ε-aminocapramide is SPOXYFZZNLEOAJ-UHFFFAOYSA-N. |
| Q: What is the LogP of N-benzoyl-ε-aminocapramide? |
| A: LogP of N-benzoyl-ε-aminocapramide is 2.55330. |
| Q: What is the molecular weight of N-benzoyl-ε-aminocapramide? |
| A: Molecular weight of N-benzoyl-ε-aminocapramide is 234.29400. |
| Q: What is the CAS number of N-benzoyl-ε-aminocapramide? |
| A: CAS number of N-benzoyl-ε-aminocapramide is 84636-44-2. |
| Q: What are the downstream products of N-benzoyl-ε-aminocapramide? |
| A: Related downstream products(CAS) of N-benzoyl-ε-aminocapramide: 956-09-2. |
| Q: What English synonyms does N-benzoyl-ε-aminocapramide have? |
| A: English synonyms of N-benzoyl-ε-aminocapramide: 6-Benzoylamino-hexansaeure-amid, 6-benzoylamino-hexanoic acid amide. |
| Q: What is the English name of N-benzoyl-ε-aminocapramide? |
| A: The English name of N-benzoyl-ε-aminocapramide is N-benzoyl-ε-aminocapramide. |
| Q: What is the SMILES notation of N-benzoyl-ε-aminocapramide? |
| A: SMILES notation of N-benzoyl-ε-aminocapramide is NC(=O)CCCCCNC(=O)c1ccccc1. |
| Q: What is the Chinese name of 84636-44-2? |
| A: Chinese name of 84636-44-2 is 84636-44-2. |
| Q: What is the polar surface area (PSA) of N-benzoyl-ε-aminocapramide? |
| A: Polar surface area (PSA) of N-benzoyl-ε-aminocapramide is 72.19000. |