1-nitro-4-[2-[2-[2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzene structure
|
Common Name | 1-nitro-4-[2-[2-[2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzene | ||
|---|---|---|---|---|
| CAS Number | 84649-38-7 | Molecular Weight | 524.51800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H32N2O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-nitro-4-[2-[2-[2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzene |
|---|
| Molecular Formula | C24H32N2O11 |
|---|---|
| Molecular Weight | 524.51800 |
| Exact Mass | 524.20100 |
| PSA | 156.25000 |
| LogP | 4.09020 |
| InChIKey | GEUVOGSCIQGBHI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCCOCCOCCOCCOCCOCCOc2ccc([N+](=O)[O-])cc2)cc1 |
|
~74%
1-nitro-4-[2-[2... CAS#:84649-38-7 |
| Literature: Shinkai, Seiji; Minami, Takahide; Kusano, Yumiko; Manabe, Osamu Journal of the American Chemical Society, 1983 , vol. 105, # 7 p. 1851 - 1856 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |