(3-methoxy-2-methylphenyl)methyl-triphenylphosphanium,chloride structure
|
Common Name | (3-methoxy-2-methylphenyl)methyl-triphenylphosphanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 84657-26-1 | Molecular Weight | 432.92200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H26ClOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-methoxy-2-methylphenyl)methyl-triphenylphosphanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H26ClOP |
|---|---|
| Molecular Weight | 432.92200 |
| Exact Mass | 432.14100 |
| PSA | 22.82000 |
| LogP | 2.50170 |
| InChIKey | YKDFNZIOFPPIRN-UHFFFAOYSA-M |
| SMILES | COc1cccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c1C.[Cl-] |
|
~%
(3-methoxy-2-me... CAS#:84657-26-1 |
| Literature: Brown, Charles; Sikkel, Bernardus J.; Carvalho, Christopher F.; Sargent, Melvyn V. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , # 12 p. 3007 - 3010 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-methoxy-2-methylbenzyltriphenylphosphonium chloride |