N-(2,2-Dioxido-3,4,5,6-tetrahydrothieno[2,3-h][1,2]benzoxathiin-4-yl)-N,N-dimethylamine structure
|
Common Name | N-(2,2-Dioxido-3,4,5,6-tetrahydrothieno[2,3-h][1,2]benzoxathiin-4-yl)-N,N-dimethylamine | ||
|---|---|---|---|---|
| CAS Number | 84670-67-7 | Molecular Weight | 285.38200 | |
| Density | 1.43g/cm3 | Boiling Point | 479.7ºC at 760 mmHg | |
| Molecular Formula | C12H15NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.9ºC | |
| Name | N,N-dimethyl-2,2-dioxo-3,4,5,6-tetrahydrothieno[2,3-h][1,2]benzoxathiin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 479.7ºC at 760 mmHg |
| Molecular Formula | C12H15NO3S2 |
| Molecular Weight | 285.38200 |
| Flash Point | 243.9ºC |
| Exact Mass | 285.04900 |
| PSA | 83.23000 |
| LogP | 2.77640 |
| Index of Refraction | 1.638 |
| InChIKey | LGKROVPAKMOXGW-UHFFFAOYSA-N |
| SMILES | CN(C)C1CS(=O)(=O)OC2=C1CCc1sccc12 |
|
~80%
N-(2,2-Dioxido-... CAS#:84670-67-7 |
| Literature: Mosti, Luisa; Schenone, Pietro; Menozzi, Giulia; Romussi, Giovanni Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 1057 - 1059 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-(2,2-Dioxido-3,4,5,6-tetrahydrothieno(2,3-h)(1,2)benzoxathiin-4-yl)-N,N-dimethylamine |