A-L-A-L structure
|
Common Name | A-L-A-L | ||
|---|---|---|---|---|
| CAS Number | 84676-48-2 | Molecular Weight | 386.48600 | |
| Density | 1.123 g/cm3 | Boiling Point | 695.6ºC at 760 mmHg | |
| Molecular Formula | C18H34N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 374.5ºC | |
Use of A-L-A-LAla-Leu-Ala-Leu is a peptide. Ala-Leu-Ala-Leu can be used for the research of experiment research[1]. |
| Name | 2-[2-[[2-(2-aminopropanoylamino)-4-methylpentanoyl]amino]propanoylamino]-4-methylpentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Ala-Leu-Ala-Leu is a peptide. Ala-Leu-Ala-Leu can be used for the research of experiment research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.123 g/cm3 |
|---|---|
| Boiling Point | 695.6ºC at 760 mmHg |
| Molecular Formula | C18H34N4O5 |
| Molecular Weight | 386.48600 |
| Flash Point | 374.5ºC |
| Exact Mass | 386.25300 |
| PSA | 150.62000 |
| LogP | 1.85770 |
| Index of Refraction | 1.499 |
| InChIKey | KQRHTCDQWJLLME-XUXIUFHCSA-N |
| SMILES | CC(C)CC(NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(C)N)C(=O)O |
| A-L-A-L |