bis(2-ethylhexyl) cyclohexane-1,4-dicarboxylate structure
|
Common Name | bis(2-ethylhexyl) cyclohexane-1,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 84731-70-4 | Molecular Weight | 396.60400 | |
| Density | 0.959g/cm3 | Boiling Point | 458.2ºC at 760 mmHg | |
| Molecular Formula | C24H44O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.7ºC | |
| Name | bis(2-ethylhexyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.959g/cm3 |
|---|---|
| Boiling Point | 458.2ºC at 760 mmHg |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.60400 |
| Flash Point | 213.7ºC |
| Exact Mass | 396.32400 |
| PSA | 52.60000 |
| LogP | 6.31200 |
| Index of Refraction | 1.465 |
| InChIKey | HOQGHOMLEVKTBY-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)C1CCC(C(=O)OCC(CC)CCCC)CC1 |
| HS Code | 2917209090 |
|---|
|
~97%
bis(2-ethylhexy... CAS#:84731-70-4 |
| Literature: BASF Aktiengesellschaft Patent: EP1194396 B1, 2005 ; Location in patent: Page/Page column 10 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| einecs 283-829-2 |