4-(3-Nitropyridin-2-yl)benzoic acid structure
|
Common Name | 4-(3-Nitropyridin-2-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 847446-89-3 | Molecular Weight | 244.20300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8N2O4 | Melting Point | 237-239ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-Nitropyridin-2-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 237-239ºC |
|---|---|
| Molecular Formula | C12H8N2O4 |
| Molecular Weight | 244.20300 |
| Exact Mass | 244.04800 |
| PSA | 96.01000 |
| LogP | 2.87820 |
| InChIKey | QQEXNJITHGFQCE-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ncccc2[N+](=O)[O-])cc1 |
| HS Code | 2933399090 |
|---|
|
~%
4-(3-Nitropyrid... CAS#:847446-89-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 15, # 3 p. 631 - 634 |
|
~%
4-(3-Nitropyrid... CAS#:847446-89-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 15, # 3 p. 631 - 634 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(3-nitro-2-pyridyl)benzoic acid |
| 4-(4-Nitropyridin-2-yl)benzoic acid |