Pacificin E
Modify Date: 2026-04-11 22:29:57
Pacificin E structure
|
Common Name | Pacificin E | ||
|---|---|---|---|---|
| CAS Number | 847450-75-3 | Molecular Weight | 338.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H34O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Pacificin E |
|---|
| Molecular Formula | C20H34O4 |
|---|---|
| Molecular Weight | 338.5 |
| InChIKey | PNSFHPGODPYTML-RTILDTPDSA-N |
| SMILES | CC(=C)C(CC[C@]1(CC[C@]2([C@@H](O2)CC[C@]([C@@H]3[C@@H]1C3)(C)O)C)C)OO |
|
Name: Cytotoxicity against mouse P388 cells at 0.5 to 50 ug/ml
Source: ChEMBL
Target: P388
External Id: CHEMBL978348
|
|
Name: Cytotoxicity against human HT-29 cells 0.5 to 50 ug/ml
Source: ChEMBL
Target: HT-29
External Id: CHEMBL978347
|
Total 2, Current Page 1 of 1
1