5-Chloro-N-hydroxy-3,4,6-trimethyl-2-benzofurancarboximidamide structure
|
Common Name | 5-Chloro-N-hydroxy-3,4,6-trimethyl-2-benzofurancarboximidamide | ||
|---|---|---|---|---|
| CAS Number | 84748-06-1 | Molecular Weight | 252.69700 | |
| Density | 1.398g/cm3 | Boiling Point | 457.38ºC at 760 mmHg | |
| Molecular Formula | C12H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.416ºC | |
| Name | 5-Chloro-N'-hydroxy-3,4,6-trimethyl-1-benzofuran-2-carboximidamid e |
|---|
| Density | 1.398g/cm3 |
|---|---|
| Boiling Point | 457.38ºC at 760 mmHg |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.69700 |
| Flash Point | 230.416ºC |
| Exact Mass | 252.06700 |
| PSA | 69.25000 |
| LogP | 3.80620 |
| Index of Refraction | 1.626 |
| InChIKey | KWVIKALCNUEIPC-UHFFFAOYSA-N |
| SMILES | Cc1cc2oc(C(N)=NO)c(C)c2c(C)c1Cl |
| HS Code | 2932999099 |
|---|
|
~65%
5-Chloro-N-hydr... CAS#:84748-06-1 |
| Literature: Riffaud; Dupont; Rene; Royer European Journal of Medicinal Chemistry, 1982 , vol. 17, # 6 p. 577 - 581 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |