3-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)prop-2-enal structure
|
Common Name | 3-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)prop-2-enal | ||
|---|---|---|---|---|
| CAS Number | 84750-76-5 | Molecular Weight | 176.25500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)prop-2-enal |
|---|
| Molecular Formula | C12H16O |
|---|---|
| Molecular Weight | 176.25500 |
| Exact Mass | 176.12000 |
| PSA | 17.07000 |
| LogP | 3.04410 |
| InChIKey | SOPQDTQPFPDPHG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=O)C(C)(C)CC=C1 |
|
~%
3-(2,6,6-trimet... CAS#:84750-76-5 |
| Literature: Yamashita; Watanabe; Oritani Agricultural and Biological Chemistry, 1982 , vol. 46, # 12 p. 3069 - 3073 |
|
~%
3-(2,6,6-trimet... CAS#:84750-76-5 |
| Literature: Yamashita; Watanabe; Oritani Agricultural and Biological Chemistry, 1982 , vol. 46, # 12 p. 3069 - 3073 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |