2,3,8-tribromodibenzofuran structure
|
Common Name | 2,3,8-tribromodibenzofuran | ||
|---|---|---|---|---|
| CAS Number | 84761-82-0 | Molecular Weight | 404.88000 | |
| Density | 2.142g/cm3 | Boiling Point | 447.4ºC at 760 mmHg | |
| Molecular Formula | C12H5Br3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.4ºC | |
| Name | 2,3,8-tribromodibenzofuran |
|---|---|
| Synonym | More Synonyms |
| Density | 2.142g/cm3 |
|---|---|
| Boiling Point | 447.4ºC at 760 mmHg |
| Molecular Formula | C12H5Br3O |
| Molecular Weight | 404.88000 |
| Flash Point | 224.4ºC |
| Exact Mass | 401.78900 |
| PSA | 13.14000 |
| LogP | 5.87350 |
| Index of Refraction | 1.753 |
| InChIKey | KKPBZUROFCCDEP-UHFFFAOYSA-N |
| SMILES | Brc1ccc2oc3cc(Br)c(Br)cc3c2c1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3,8-tribromo-dibenzofuran |
| Dibenzofuran,2,3,8-tribromo |
| 2,3,8-Tribrom-dibenzofuran |