3-(2,3-dimethylphenyl)-2-sulfanylidene-1H-quinazolin-4-one
Modify Date: 2025-09-13 16:33:34
3-(2,3-dimethylphenyl)-2-sulfanylidene-1H-quinazolin-4-one structure
|
Common Name | 3-(2,3-dimethylphenyl)-2-sulfanylidene-1H-quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 84772-24-7 | Molecular Weight | 282.36000 | |
| Density | 1.33g/cm3 | Boiling Point | 455.7ºC at 760 mmHg | |
| Molecular Formula | C16H14N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.4ºC | |
| Name | 3-(2,3-dimethylphenyl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 455.7ºC at 760 mmHg |
| Molecular Formula | C16H14N2OS |
| Molecular Weight | 282.36000 |
| Flash Point | 229.4ºC |
| Exact Mass | 282.08300 |
| PSA | 73.69000 |
| LogP | 3.29120 |
| Index of Refraction | 1.707 |
| InChIKey | FJHSJZYYXVHWAY-UHFFFAOYSA-N |
| SMILES | Cc1cccc(-n2c(=S)[nH]c3ccccc3c2=O)c1C |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:84772-16-7
CAS#:67116-97-6| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(2,3-Dimethyl-phenyl)-2-mercapto-3H-quinazolin-4-one |
| 3-(2,3-dimethylphenyl)-2-sulfanyl-3-hydroquinazolin-4-one |