1,2-Benzenedicarboxylic acid, dipentyl ester, branched and linear
Modify Date: 2024-01-03 18:06:48
1,2-Benzenedicarboxylic acid, dipentyl ester, branched and linear structure
|
Common Name | 1,2-Benzenedicarboxylic acid, dipentyl ester, branched and linear | ||
|---|---|---|---|---|
| CAS Number | 84777-06-0 | Molecular Weight | 304.38100 | |
| Density | N/A | Boiling Point | 439.4ºC at 760 mmHg | |
| Molecular Formula | C18H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.7ºC | |
| Name | 3,4-Bis(3-methylbutyl)phthalate |
|---|
| Boiling Point | 439.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.38100 |
| Flash Point | 233.7ºC |
| Exact Mass | 304.16700 |
| PSA | 80.26000 |
| LogP | 1.59080 |
| InChIKey | YRWFRHKQYQHUTP-UHFFFAOYSA-L |
| SMILES | CC(C)CCc1ccc(C(=O)[O-])c(C(=O)[O-])c1CCC(C)C |