3-(4-chlorophenyl)-1-(4-methylphenyl)-1-nitrosourea structure
|
Common Name | 3-(4-chlorophenyl)-1-(4-methylphenyl)-1-nitrosourea | ||
|---|---|---|---|---|
| CAS Number | 84784-24-7 | Molecular Weight | 289.71700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-chlorophenyl)-1-(4-methylphenyl)-1-nitrosourea |
|---|
| Molecular Formula | C14H12ClN3O2 |
|---|---|
| Molecular Weight | 289.71700 |
| Exact Mass | 289.06200 |
| PSA | 61.77000 |
| LogP | 4.44130 |
| InChIKey | GJISXFVZUSBTLD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N(N=O)C(=O)Nc2ccc(Cl)cc2)cc1 |
|
~90%
3-(4-chlorophen... CAS#:84784-24-7 |
| Literature: Miyahara Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 5 p. 1950 - 1960 |
|
~%
3-(4-chlorophen... CAS#:84784-24-7 |
| Literature: Miyahara Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 5 p. 1950 - 1960 |
|
~%
3-(4-chlorophen... CAS#:84784-24-7 |
| Literature: Miyahara Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 5 p. 1950 - 1960 |
|
~%
3-(4-chlorophen... CAS#:84784-24-7 |
| Literature: Miyahara Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 5 p. 1950 - 1960 |