Pyridinium, 1-(1-cyano-2-ethoxy-2-oxoethyl)-4-methyl-,inner salt structure
|
Common Name | Pyridinium, 1-(1-cyano-2-ethoxy-2-oxoethyl)-4-methyl-,inner salt | ||
|---|---|---|---|---|
| CAS Number | 84802-40-4 | Molecular Weight | 204.22500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-2-cyano-1-ethoxy-2-(4-methylpyridin-1-ium-1-yl)ethenolate |
|---|
| Molecular Formula | C11H12N2O2 |
|---|---|
| Molecular Weight | 204.22500 |
| Exact Mass | 204.09000 |
| PSA | 58.48000 |
| LogP | 1.54438 |
| InChIKey | WNTHVMPPTUKPJX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=C=[N-])[n+]1ccc(C)cc1 |
|
~51%
Pyridinium, 1-(... CAS#:84802-40-4 |
| Literature: Kakehi, Akikazu; Ito, Suketaka; Hashimoto, Yasunobu Bulletin of the Chemical Society of Japan, 1996 , vol. 69, # 6 p. 1769 - 1776 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |