N-(2-chloro-6-nitrophenyl)-N-phenylacetamide structure
|
Common Name | N-(2-chloro-6-nitrophenyl)-N-phenylacetamide | ||
|---|---|---|---|---|
| CAS Number | 84803-52-1 | Molecular Weight | 290.70200 | |
| Density | 1.374g/cm3 | Boiling Point | 498ºC at 760 mmHg | |
| Molecular Formula | C14H11ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255ºC | |
| Name | N-(2-chloro-6-nitrophenyl)-N-phenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 498ºC at 760 mmHg |
| Molecular Formula | C14H11ClN2O3 |
| Molecular Weight | 290.70200 |
| Flash Point | 255ºC |
| Exact Mass | 290.04600 |
| PSA | 66.13000 |
| LogP | 4.45600 |
| Index of Refraction | 1.642 |
| InChIKey | DLXYWZMHUVVOFZ-UHFFFAOYSA-N |
| SMILES | CC(=O)N(c1ccccc1)c1c(Cl)cccc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 284-178-7 |
| Acetamide,N-(2-chloro-6-nitrophenyl)-N-phenyl |