1,5-bis(4-chlorophenyl)-2,2-dimethylimidazo[4,5-b]phenazine structure
|
Common Name | 1,5-bis(4-chlorophenyl)-2,2-dimethylimidazo[4,5-b]phenazine | ||
|---|---|---|---|---|
| CAS Number | 84803-71-4 | Molecular Weight | 471.38100 | |
| Density | 1.35g/cm3 | Boiling Point | 573ºC at 760 mmHg | |
| Molecular Formula | C27H20Cl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.3ºC | |
| Name | 1,5-bis(4-chlorophenyl)-2,2-dimethylimidazo[4,5-b]phenazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 573ºC at 760 mmHg |
| Molecular Formula | C27H20Cl2N4 |
| Molecular Weight | 471.38100 |
| Flash Point | 300.3ºC |
| Exact Mass | 470.10700 |
| PSA | 33.42000 |
| LogP | 6.77460 |
| Index of Refraction | 1.701 |
| InChIKey | HFSRYMCNSIJDJB-UHFFFAOYSA-N |
| SMILES | CC1(C)N=c2cc3c(cc2N1c1ccc(Cl)cc1)=Nc1ccccc1N3c1ccc(Cl)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 284-199-1 |