(E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine
Modify Date: 2026-04-28 14:59:04
(E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine structure
|
Common Name | (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine | ||
|---|---|---|---|---|
| CAS Number | 84814-06-2 | Molecular Weight | 314.65700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H38N2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H38N2Si2 |
|---|---|
| Molecular Weight | 314.65700 |
| Exact Mass | 314.25700 |
| PSA | 6.48000 |
| LogP | 5.32840 |
| InChIKey | CIUCHYCADICHHI-BUHFOSPRSA-N |
| SMILES | CC(C)(C)N(C=CN(C(C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine? |
| A: CAS number of (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine is 84814-06-2. |
| Q: What is the molecular weight of (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine? |
| A: Molecular weight of (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine is 314.65700. |
| Q: What is the English name of (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine? |
| A: The English name of (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine is (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine. |
| Q: What is the InChIKey of (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine? |
| A: InChIKey of (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine is CIUCHYCADICHHI-BUHFOSPRSA-N. |
| Q: What is the SMILES notation of (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine? |
| A: SMILES notation of (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine is CC(C)(C)N(C=CN(C(C)(C)C)[Si](C)(C)C)[Si](C)(C)C. |
| Q: What is the molecular formula of (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine? |
| A: Molecular formula of (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine is C16H38N2Si2. |
| Q: What is the LogP of (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine? |
| A: LogP of (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine is 5.32840. |
| Q: What is the Chinese name of 84814-06-2? |
| A: Chinese name of 84814-06-2 is 84814-06-2. |
| Q: What is the polar surface area (PSA) of (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine? |
| A: Polar surface area (PSA) of (E)-N,N'-ditert-butyl-N,N'-bis(trimethylsilyl)ethene-1,2-diamine is 6.48000. |