3-chloro-2-(3-chloro-4-hydroxyphenyl)-2H-indazol-5-ol
Modify Date: 2025-08-27 19:44:03
3-chloro-2-(3-chloro-4-hydroxyphenyl)-2H-indazol-5-ol structure
|
Common Name | 3-chloro-2-(3-chloro-4-hydroxyphenyl)-2H-indazol-5-ol | ||
|---|---|---|---|---|
| CAS Number | 848142-63-2 | Molecular Weight | 295.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-2-(3-chloro-4-hydroxyphenyl)-2H-indazol-5-ol |
|---|
| Molecular Formula | C13H8Cl2N2O2 |
|---|---|
| Molecular Weight | 295.12 |
| InChIKey | CRSUASWTVZUAHY-UHFFFAOYSA-N |
| SMILES | Oc1ccc2nn(-c3ccc(O)c(Cl)c3)c(Cl)c2c1 |
|
Name: Relative binding affinity for human estrogen receptor alpha
Source: ChEMBL
Target: Estrogen receptor
External Id: CHEMBL836278
|
|
Name: Relative binding affinity for human estrogen receptor beta
Source: ChEMBL
Target: Estrogen receptor beta
External Id: CHEMBL836277
|
|
Name: Relative binding affinities for estrogen receptor beta and estrogen receptor alpha
Source: ChEMBL
Target: Estrogen receptor beta
External Id: CHEMBL829971
|
Total 3, Current Page 1 of 1
1