Ethyl (2,3-Dihydro-1H-inden-5-ylamino)acetate structure
|
Common Name | Ethyl (2,3-Dihydro-1H-inden-5-ylamino)acetate | ||
|---|---|---|---|---|
| CAS Number | 84827-40-7 | Molecular Weight | 219.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(2,3-dihydro-1H-inden-5-ylamino)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H17NO2 |
|---|---|
| Molecular Weight | 219.28000 |
| Exact Mass | 219.12600 |
| PSA | 38.33000 |
| LogP | 2.22330 |
| InChIKey | IDCLWTLFGKJVQO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNc1ccc2c(c1)CCC2 |
| HS Code | 2922499990 |
|---|
|
~44%
Ethyl (2,3-Dihy... CAS#:84827-40-7 |
| Literature: Suh; Regan; Skiles; et al. European Journal of Medicinal Chemistry, 1985 , vol. 20, # 6 p. 563 - 570 |
|
~%
Ethyl (2,3-Dihy... CAS#:84827-40-7 |
| Literature: Stanton; Gruenfeld; Babiarz; Ackerman; Friedmann; Yuan; Macchia Journal of Medicinal Chemistry, 1983 , vol. 26, # 9 p. 1267 - 1277 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Ethyl (2,3-Dihydro-1H-inden-5-ylamino)acetate |
| ethyl 2-(indan-5-ylamino)acetate |
| ethyl N-(5-indanyl)-glycinate |
| N-(2,3-dihydro-1H-inden-5-yl)glycine ethyl ester |