ethyl N-[4-[3-[(4-chlorophenyl)carbamoyl]thiazolidin-2-yl]phenyl]carbamate structure
|
Common Name | ethyl N-[4-[3-[(4-chlorophenyl)carbamoyl]thiazolidin-2-yl]phenyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 84832-94-0 | Molecular Weight | 405.89800 | |
| Density | 1.399g/cm3 | Boiling Point | 592ºC at 760mmHg | |
| Molecular Formula | C19H20ClN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.9ºC | |
| Name | ethyl N-[4-[3-[(4-chlorophenyl)carbamoyl]-1,3-thiazolidin-2-yl]phenyl]carbamate |
|---|
| Density | 1.399g/cm3 |
|---|---|
| Boiling Point | 592ºC at 760mmHg |
| Molecular Formula | C19H20ClN3O3S |
| Molecular Weight | 405.89800 |
| Flash Point | 311.9ºC |
| Exact Mass | 405.09100 |
| PSA | 95.97000 |
| LogP | 5.27180 |
| InChIKey | CVLYCSIGZJKOAV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1ccc(C2SCCN2C(=O)Nc2ccc(Cl)cc2)cc1 |
|
~95%
ethyl N-[4-[3-[... CAS#:84832-94-0 |
| Literature: Witek, Stanislaw; Bielawska, Alicja; Bielawski, Jacek Polish Journal of Chemistry, 1981 , vol. 55, # 5 p. 1043 - 1048 |
|
~%
ethyl N-[4-[3-[... CAS#:84832-94-0 |
| Literature: Witek, Stanislaw; Bielawska, Alicja; Bielawski, Jacek Polish Journal of Chemistry, 1981 , vol. 55, # 5 p. 1043 - 1048 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |