(2,3,4,5,6-pentafluorophenyl) pyridine-3-carboxylate structure
|
Common Name | (2,3,4,5,6-pentafluorophenyl) pyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 848347-44-4 | Molecular Weight | 289.15800 | |
| Density | 1.545g/cm3 | Boiling Point | 398.5ºC at 760 mmHg | |
| Molecular Formula | C12H4F5NO2 | Melting Point | 65.5ºC | |
| MSDS | N/A | Flash Point | 194.8ºC | |
| Name | (2,3,4,5,6-pentafluorophenyl) pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.545g/cm3 |
|---|---|
| Boiling Point | 398.5ºC at 760 mmHg |
| Melting Point | 65.5ºC |
| Molecular Formula | C12H4F5NO2 |
| Molecular Weight | 289.15800 |
| Flash Point | 194.8ºC |
| Exact Mass | 289.01600 |
| PSA | 39.19000 |
| LogP | 2.99630 |
| Index of Refraction | 1.509 |
| InChIKey | AXHLJDBUUFUDCF-UHFFFAOYSA-N |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1cccnc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pentafluorophenyl pyridine-3-carboxylate |
| Y4214 |
| Pentafluorophenyl nicotinate |