2-(4-methoxyphenyl)-2-methylcyclohexan-1-one structure
|
Common Name | 2-(4-methoxyphenyl)-2-methylcyclohexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 84839-21-4 | Molecular Weight | 218.29200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-methoxyphenyl)-2-methylcyclohexan-1-one |
|---|
| Molecular Formula | C14H18O2 |
|---|---|
| Molecular Weight | 218.29200 |
| Exact Mass | 218.13100 |
| PSA | 26.30000 |
| LogP | 3.09600 |
| InChIKey | PPURKAMLZDCZHH-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2(C)CCCCC2=O)cc1 |
|
~34%
2-(4-methoxyphe... CAS#:84839-21-4 |
| Literature: Morgan, Jacqueline; Pinhey, John T.; Rowe, Bruce A. Journal of the Chemical Society - Perkin Transactions 1, 1997 , # 7 p. 1005 - 1008 |
|
~%
2-(4-methoxyphe... CAS#:84839-21-4 |
| Literature: Palitzsch, P.; Huneck, S.; Fischer, F. Journal fuer Praktische Chemie (Leipzig), 1986 , vol. 328, # 1 p. 42 - 54 |