2-(4-isobutylcyclohexyl)-2-oxoethyl benzenesulfonate structure
|
Common Name | 2-(4-isobutylcyclohexyl)-2-oxoethyl benzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 84856-18-8 | Molecular Weight | 338.46200 | |
| Density | 1.123g/cm3 | Boiling Point | 460.1ºC at 760 mmHg | |
| Molecular Formula | C18H26O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232ºC | |
| Name | [2-[4-(2-methylpropyl)cyclohexyl]-2-oxoethyl] benzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.123g/cm3 |
|---|---|
| Boiling Point | 460.1ºC at 760 mmHg |
| Molecular Formula | C18H26O4S |
| Molecular Weight | 338.46200 |
| Flash Point | 232ºC |
| Exact Mass | 338.15500 |
| PSA | 68.82000 |
| LogP | 4.89430 |
| Index of Refraction | 1.515 |
| InChIKey | RLVLLBHWAQWLKL-UHFFFAOYSA-N |
| SMILES | CC(C)CC1CCC(C(=O)COS(=O)(=O)c2ccccc2)CC1 |
| HS Code | 2914400090 |
|---|
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| fl 386 |