1-(4-bromophenyl)-2,2,2-trifluoroethyl trifluoromethanesulfonate structure
|
Common Name | 1-(4-bromophenyl)-2,2,2-trifluoroethyl trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 84877-48-5 | Molecular Weight | 387.09400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5BrF6O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [1-(4-bromophenyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H5BrF6O3S |
|---|---|
| Molecular Weight | 387.09400 |
| Exact Mass | 385.90500 |
| PSA | 51.75000 |
| LogP | 4.99950 |
| InChIKey | MBXWQSSLQSIJEP-UHFFFAOYSA-N |
| SMILES | O=S(=O)(OC(c1ccc(Br)cc1)C(F)(F)F)C(F)(F)F |
| HS Code | 2906299090 |
|---|
|
~%
1-(4-bromopheny... CAS#:84877-48-5 |
| Literature: Allen, Annette D.; Ambidge, I. Christopher; Che, Claudius; Micheal, Hany; Muir, Ronald J.; Tidwell, Thomas T. Journal of the American Chemical Society, 1983 , vol. 105, # 8 p. 2343 - 2350 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1-(4-bromophenyl)-2,2,2-trifluoroethyl trifluoromethanesulfonate |