(4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate
(4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate structure
|
Common Name | (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate | ||
|---|---|---|---|---|
| CAS Number | 849-83-2 | Molecular Weight | 302.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14O6 |
|---|---|
| Molecular Weight | 302.27900 |
| Exact Mass | 302.07900 |
| PSA | 71.06000 |
| LogP | 2.63260 |
| InChIKey | KDFRADWZKMRRPJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)OOC(=O)c2ccc(OC)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~99%
(4-methoxybenzo... CAS#:849-83-2 |
| Literature: Flowers, G. Craig; Leffler, John E. Journal of Organic Chemistry, 1985 , vol. 50, # 22 p. 4406 - 4408 |
|
~%
(4-methoxybenzo... CAS#:849-83-2 |
| Literature: Greene,F.D.; Kazan,J. Journal of Organic Chemistry, 1963 , vol. 28, p. 2168 - 2171 |
|
~%
Detail
Learn More
|
| Literature: Vanino; Uhlfelder Chemische Berichte, 1904 , vol. 37, p. 3624 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-methoxylbenzoic peroxyanhydride |
| 4,4'-dimethoxydibenzoyl peroxide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 849-83-2? |
| A: Chinese name of 849-83-2 is 849-83-2. |
| Q: What is the LogP of (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate? |
| A: LogP of (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate is 2.63260. |
| Q: What is the molecular weight of (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate? |
| A: Molecular weight of (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate is 302.27900. |
| Q: What is the English name of (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate? |
| A: The English name of (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate is (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate. |
| Q: What is the polar surface area (PSA) of (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate? |
| A: Polar surface area (PSA) of (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate is 71.06000. |
| Q: What is the molecular formula of (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate? |
| A: Molecular formula of (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate is C16H14O6. |
| Q: What is the CAS number of (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate? |
| A: CAS number of (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate is 849-83-2. |
| Q: What is the InChIKey of (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate? |
| A: InChIKey of (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate is KDFRADWZKMRRPJ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate? |
| A: SMILES notation of (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate is COc1ccc(C(=O)OOC(=O)c2ccc(OC)cc2)cc1. |
| Q: What English synonyms does (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate have? |
| A: English synonyms of (4-methoxybenzoyl) 4-methoxybenzenecarboperoxoate: 4-methoxylbenzoic peroxyanhydride, 4,4'-dimethoxydibenzoyl peroxide. |