5H-Pyrrolo(3,2-d)pyrimidin-4-amine, N-(2-(1-cyclohexen-1-yl)ethyl)- structure
|
Common Name | 5H-Pyrrolo(3,2-d)pyrimidin-4-amine, N-(2-(1-cyclohexen-1-yl)ethyl)- | ||
|---|---|---|---|---|
| CAS Number | 84905-70-4 | Molecular Weight | 242.32000 | |
| Density | 1.223g/cm3 | Boiling Point | 472.5ºC at 760 mmHg | |
| Molecular Formula | C14H18N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.6ºC | |
| Name | N-[2-(cyclohexen-1-yl)ethyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.223g/cm3 |
|---|---|
| Boiling Point | 472.5ºC at 760 mmHg |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.32000 |
| Flash Point | 239.6ºC |
| Exact Mass | 242.15300 |
| PSA | 56.83000 |
| LogP | 2.68220 |
| Index of Refraction | 1.672 |
| InChIKey | WNJHJCKCHDRDGI-UHFFFAOYSA-N |
| SMILES | C1=C(CCNc2ncnc3cc[nH]c23)CCCC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(2-(1-Cyclohexen-1-yl)ethyl)-5H-pyrrolo(3,2-d)pyrimidin-4-amine |
| 5H-Pyrrolo(3,2-d)pyrimidin-4-amine,N-(2-(1-cyclohexen-1-yl)ethyl) |