7-(2-hydroxyethyl)-1,3-dimethyl-purine-2,6-dione, (3,3,5-trimethylcycl ohexyl) 2-hydroxy-2-phenyl-acetate structure
|
Common Name | 7-(2-hydroxyethyl)-1,3-dimethyl-purine-2,6-dione, (3,3,5-trimethylcycl ohexyl) 2-hydroxy-2-phenyl-acetate | ||
|---|---|---|---|---|
| CAS Number | 84930-23-4 | Molecular Weight | 500.587 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H36N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3,5-Trimethylcyclohexyl hydroxy(phenyl)acetate-7-(2-hydroxyethyl)-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H36N4O6 |
|---|---|
| Molecular Weight | 500.587 |
| Exact Mass | 500.263489 |
| InChIKey | XWJRBYJNVOQFOC-UHFFFAOYSA-N |
| SMILES | CC1CC(OC(=O)C(O)c2ccccc2)CC(C)(C)C1.Cn1c(=O)c2c(ncn2CCO)n(C)c1=O |
| Benzeneacetic acid, α-hydroxy-, 3,3,5-trimethylcyclohexyl ester, mixt. with 3,7-dihydro-7-(2-hydroxyethyl)-1,3-dimethyl-1H-purine-2,6-dione |
| 3,3,5-Trimethylcyclohexyl hydroxy(phenyl)acetate - 7-(2-hydroxyethyl)-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione (1:1) |
| Benzeneacetic acid, α-hydroxy-, 3,3,5-trimethylcyclohexyl ester, compd. with 3,7-dihydro-7-(2-hydroxyethyl)-1,3-dimethyl-1H-purine-2,6-dione (1:1) |