1,3,5-triazine-2,4,6(1H,3H,5H)-trione compound with 1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazone (1:1) structure
|
Common Name | 1,3,5-triazine-2,4,6(1H,3H,5H)-trione compound with 1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazone (1:1) | ||
|---|---|---|---|---|
| CAS Number | 84946-02-1 | Molecular Weight | 300.23800 | |
| Density | N/A | Boiling Point | 550.5ºC at 760 mmHg | |
| Molecular Formula | C6H12N12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.7ºC | |
| Name | (4,6-dihydrazinyl-1,3,5-triazin-2-yl)hydrazine,1,3,5-triazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 550.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C6H12N12O3 |
| Molecular Weight | 300.23800 |
| Flash Point | 286.7ºC |
| Exact Mass | 300.11600 |
| PSA | 252.18000 |
| InChIKey | XCWVTLZSOWPVGC-UHFFFAOYSA-N |
| SMILES | NNc1nc(NN)nc(NN)n1.O=c1[nH]c(=O)[nH]c(=O)[nH]1 |
| einecs 284-604-1 |