(8alpha,9R)-10,11-dihydro-6'-methoxy-5'-nitrocinchonan-9-ol structure
|
Common Name | (8alpha,9R)-10,11-dihydro-6'-methoxy-5'-nitrocinchonan-9-ol | ||
|---|---|---|---|---|
| CAS Number | 84946-09-8 | Molecular Weight | 369.41400 | |
| Density | 1.31g/cm3 | Boiling Point | 561.3ºC at 760mmHg | |
| Molecular Formula | C20H23N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.3ºC | |
| Name | (5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxy-5-nitroquinolin-4-yl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 561.3ºC at 760mmHg |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.41400 |
| Flash Point | 293.3ºC |
| Exact Mass | 369.16900 |
| PSA | 91.41000 |
| LogP | 3.54250 |
| Index of Refraction | 1.642 |
| InChIKey | BEPHXQCZXDYFBG-UHFFFAOYSA-N |
| SMILES | C=CC1CN2CCC1CC2C(O)c1ccnc2ccc(OC)c([N+](=O)[O-])c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 284-612-5 |