N-(2-chloroethyl)-2-nitrobenzamide structure
|
Common Name | N-(2-chloroethyl)-2-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 84946-21-4 | Molecular Weight | 228.63200 | |
| Density | 1.348g/cm3 | Boiling Point | 412.1ºC at 760 mmHg | |
| Molecular Formula | C9H9ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203ºC | |
| Name | N-(2-chloroethyl)-2-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348g/cm3 |
|---|---|
| Boiling Point | 412.1ºC at 760 mmHg |
| Molecular Formula | C9H9ClN2O3 |
| Molecular Weight | 228.63200 |
| Flash Point | 203ºC |
| Exact Mass | 228.03000 |
| PSA | 78.41000 |
| LogP | 2.66140 |
| Index of Refraction | 1.573 |
| InChIKey | JMTMTKFVHPTYCR-UHFFFAOYSA-N |
| SMILES | O=C(NCCCl)c1ccccc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~%
N-(2-chloroethy... CAS#:84946-21-4 |
| Literature: Poindexter, Graham S. Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1431 - 1433 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzamide,N-(2-chloroethyl)-2-nitro |
| EINECS 284-625-6 |
| BEN561 |